C7H9N3O4S — CID 62144576
2-(methylamino)-4-nitrobenzenesulfonamide (PubChem CID 62144576) has the molecular formula C7H9N3O4S and a molecular weight of 231.23 g/mol. Its IUPAC name is 2-(methylamino)-4-nitrobenzenesulfonamide.
| Compound Name | 2-(methylamino)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 62144576 |
| Molecular Formula | C7H9N3O4S |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 2-(methylamino)-4-nitrobenzenesulfonamide |
| SMILES | CNc1cc([N+](=O)[O-])ccc1S(N)(=O)=O |
| InChI | InChI=1S/C7H9N3O4S/c1-9-6-4-5(10(11)12)2-3-7(6)15(8,13)14/h2-4,9H,1H3,(H2,8,13,14) |
| InChIKey | QNECLWDOFNUVTG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|