C11H11N5O4S — CID 62162479
N,N-bis(cyanomethyl)-2-(methylamino)-4-nitrobenzenesulfonamide (PubChem CID 62162479) has the molecular formula C11H11N5O4S and a molecular weight of 309.31 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-2-(methylamino)-4-nitrobenzenesulfonamide.
| Compound Name | N,N-bis(cyanomethyl)-2-(methylamino)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 62162479 |
| Molecular Formula | C11H11N5O4S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | N,N-bis(cyanomethyl)-2-(methylamino)-4-nitrobenzenesulfonamide |
| SMILES | CNc1cc([N+](=O)[O-])ccc1S(=O)(=O)N(CC#N)CC#N |
| InChI | InChI=1S/C11H11N5O4S/c1-14-10-8-9(16(17)18)2-3-11(10)21(19,20)15(6-4-12)7-5-13/h2-3,8,14H,6-7H2,1H3 |
| InChIKey | DFFCGJGJKJVMJM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 140.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|