C11H17N3O4S2 — CID 63962710
2-(methylamino)-N-(3-methylsulfanylpropyl)-4-nitrobenzenesulfonamide (PubChem CID 63962710) has the molecular formula C11H17N3O4S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-(methylamino)-N-(3-methylsulfanylpropyl)-4-nitrobenzenesulfonamide.
| Compound Name | 2-(methylamino)-N-(3-methylsulfanylpropyl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 63962710 |
| Molecular Formula | C11H17N3O4S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-(methylamino)-N-(3-methylsulfanylpropyl)-4-nitrobenzenesulfonamide |
| SMILES | CNc1cc([N+](=O)[O-])ccc1S(=O)(=O)NCCCSC |
| InChI | InChI=1S/C11H17N3O4S2/c1-12-10-8-9(14(15)16)4-5-11(10)20(17,18)13-6-3-7-19-2/h4-5,8,12-13H,3,6-7H2,1-2H3 |
| InChIKey | RCPGEDIEOAUCJD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|