C10H12F3N3O4S — CID 63227659
2-(methylamino)-5-nitro-N-(3,3,3-trifluoropropyl)benzenesulfonamide (PubChem CID 63227659) has the molecular formula C10H12F3N3O4S and a molecular weight of 327.28 g/mol. Its IUPAC name is 2-(methylamino)-5-nitro-N-(3,3,3-trifluoropropyl)benzenesulfonamide.
| Compound Name | 2-(methylamino)-5-nitro-N-(3,3,3-trifluoropropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63227659 |
| Molecular Formula | C10H12F3N3O4S |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 2-(methylamino)-5-nitro-N-(3,3,3-trifluoropropyl)benzenesulfonamide |
| SMILES | CNc1ccc([N+](=O)[O-])cc1S(=O)(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C10H12F3N3O4S/c1-14-8-3-2-7(16(17)18)6-9(8)21(19,20)15-5-4-10(11,12)13/h2-3,6,14-15H,4-5H2,1H3 |
| InChIKey | PXVLMNMNIRYQDN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|