C8H13N5O6S2 — CID 43552599
2-hydrazinyl-5-nitro-N-(2-sulfamoylethyl)benzenesulfonamide (PubChem CID 43552599) has the molecular formula C8H13N5O6S2 and a molecular weight of 339.36 g/mol. Its IUPAC name is 2-hydrazinyl-5-nitro-N-(2-sulfamoylethyl)benzenesulfonamide.
| Compound Name | 2-hydrazinyl-5-nitro-N-(2-sulfamoylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43552599 |
| Molecular Formula | C8H13N5O6S2 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2-hydrazinyl-5-nitro-N-(2-sulfamoylethyl)benzenesulfonamide |
| SMILES | NNc1ccc([N+](=O)[O-])cc1S(=O)(=O)NCCS(N)(=O)=O |
| InChI | InChI=1S/C8H13N5O6S2/c9-12-7-2-1-6(13(14)15)5-8(7)21(18,19)11-3-4-20(10,16)17/h1-2,5,11-12H,3-4,9H2,(H2,10,16,17) |
| InChIKey | BWYOIJBNRPCMGA-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 187.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|