C11H19N5O4S — CID 82939806
N-[1-(dimethylamino)propan-2-yl]-2-hydrazinyl-5-nitrobenzenesulfonamide (PubChem CID 82939806) has the molecular formula C11H19N5O4S and a molecular weight of 317.37 g/mol. Its IUPAC name is N-[1-(dimethylamino)propan-2-yl]-2-hydrazinyl-5-nitrobenzenesulfonamide.
| Compound Name | N-[1-(dimethylamino)propan-2-yl]-2-hydrazinyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 82939806 |
| Molecular Formula | C11H19N5O4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[1-(dimethylamino)propan-2-yl]-2-hydrazinyl-5-nitrobenzenesulfonamide |
| SMILES | CC(CN(C)C)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1NN |
| InChI | InChI=1S/C11H19N5O4S/c1-8(7-15(2)3)14-21(19,20)11-6-9(16(17)18)4-5-10(11)13-12/h4-6,8,13-14H,7,12H2,1-3H3 |
| InChIKey | MQZBGUZQDGHEAK-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|