C10H15N3O6S2 — CID 64644430
2-amino-N-(1-methylsulfonylpropan-2-yl)-5-nitrobenzenesulfonamide (PubChem CID 64644430) has the molecular formula C10H15N3O6S2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-amino-N-(1-methylsulfonylpropan-2-yl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-amino-N-(1-methylsulfonylpropan-2-yl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 64644430 |
| Molecular Formula | C10H15N3O6S2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 2-amino-N-(1-methylsulfonylpropan-2-yl)-5-nitrobenzenesulfonamide |
| SMILES | CC(CS(C)(=O)=O)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1N |
| InChI | InChI=1S/C10H15N3O6S2/c1-7(6-20(2,16)17)12-21(18,19)10-5-8(13(14)15)3-4-9(10)11/h3-5,7,12H,6,11H2,1-2H3 |
| InChIKey | YBYKYZZZVQPPAG-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 149.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|