C12H19N3O4S — CID 104829823
2-amino-N-(3,3-dimethylbutan-2-yl)-5-nitrobenzenesulfonamide (PubChem CID 104829823) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-amino-N-(3,3-dimethylbutan-2-yl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-amino-N-(3,3-dimethylbutan-2-yl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 104829823 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-amino-N-(3,3-dimethylbutan-2-yl)-5-nitrobenzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1cc([N+](=O)[O-])ccc1N)C(C)(C)C |
| InChI | InChI=1S/C12H19N3O4S/c1-8(12(2,3)4)14-20(18,19)11-7-9(15(16)17)5-6-10(11)13/h5-8,14H,13H2,1-4H3 |
| InChIKey | ZGHZEOIWMJBUNK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|