C10H12N6O4S — CID 64531575
2-hydrazinyl-N-(1H-imidazol-2-ylmethyl)-5-nitrobenzenesulfonamide (PubChem CID 64531575) has the molecular formula C10H12N6O4S and a molecular weight of 312.31 g/mol. Its IUPAC name is 2-hydrazinyl-N-(1H-imidazol-2-ylmethyl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-hydrazinyl-N-(1H-imidazol-2-ylmethyl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 64531575 |
| Molecular Formula | C10H12N6O4S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-hydrazinyl-N-(1H-imidazol-2-ylmethyl)-5-nitrobenzenesulfonamide |
| SMILES | NNc1ccc([N+](=O)[O-])cc1S(=O)(=O)NCc1ncc[nH]1 |
| InChI | InChI=1S/C10H12N6O4S/c11-15-8-2-1-7(16(17)18)5-9(8)21(19,20)14-6-10-12-3-4-13-10/h1-5,14-15H,6,11H2,(H,12,13) |
| InChIKey | YQOQUZBOQUAPTA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 156.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|