C10H10N4O5S — CID 64532316
4-hydroxy-N-(1H-imidazol-2-ylmethyl)-3-nitrobenzenesulfonamide (PubChem CID 64532316) has the molecular formula C10H10N4O5S and a molecular weight of 298.28 g/mol. Its IUPAC name is 4-hydroxy-N-(1H-imidazol-2-ylmethyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-hydroxy-N-(1H-imidazol-2-ylmethyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 64532316 |
| Molecular Formula | C10H10N4O5S |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 4-hydroxy-N-(1H-imidazol-2-ylmethyl)-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)NCc2ncc[nH]2)ccc1O |
| InChI | InChI=1S/C10H10N4O5S/c15-9-2-1-7(5-8(9)14(16)17)20(18,19)13-6-10-11-3-4-12-10/h1-5,13,15H,6H2,(H,11,12) |
| InChIKey | PBXMSUVQRMAQGI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|