C9H11ClN2O6S2 — CID 60918252
2-chloro-N-(2-methylsulfonylethyl)-5-nitrobenzenesulfonamide (PubChem CID 60918252) has the molecular formula C9H11ClN2O6S2 and a molecular weight of 342.78 g/mol. Its IUPAC name is 2-chloro-N-(2-methylsulfonylethyl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-chloro-N-(2-methylsulfonylethyl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 60918252 |
| Molecular Formula | C9H11ClN2O6S2 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 2-chloro-N-(2-methylsulfonylethyl)-5-nitrobenzenesulfonamide |
| SMILES | CS(=O)(=O)CCNS(=O)(=O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C9H11ClN2O6S2/c1-19(15,16)5-4-11-20(17,18)9-6-7(12(13)14)2-3-8(9)10/h2-3,6,11H,4-5H2,1H3 |
| InChIKey | VDVWUKNKXIISPC-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 123.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|