About ethane;[2-methyl-6-(methylamino)-4-nitrophenyl] formate
ethane;[2-methyl-6-(methylamino)-4-nitrophenyl] formate (PubChem CID 143884541) has the molecular formula C11H16N2O4
and a molecular weight of 240.26 g/mol. Its IUPAC name is ethane;[2-methyl-6-(methylamino)-4-nitrophenyl] formate.
Molecular Properties
| Compound Name | ethane;[2-methyl-6-(methylamino)-4-nitrophenyl] formate |
| PubChem CID | 143884541 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | ethane;[2-methyl-6-(methylamino)-4-nitrophenyl] formate |
| SMILES | CC.CNc1cc([N+](=O)[O-])cc(C)c1OC=O |
| InChI | InChI=1S/C9H10N2O4.C2H6/c1-6-3-7(11(13)14)4-8(10-2)9(6)15-5-12;1-2/h3-5,10H,1-2H3;1-2H3 |
| InChIKey | WEFLVVPDUAXEAL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;[2-methyl-6-(methylamino)-4-nitrophenyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[2-methyl-6-(methylamino)-4-nitrophenyl] formate?
The IUPAC name of ethane;[2-methyl-6-(methylamino)-4-nitrophenyl] formate (CID 143884541) is ethane;[2-methyl-6-(methylamino)-4-nitrophenyl] formate.
What is the SMILES notation for ethane;[2-methyl-6-(methylamino)-4-nitrophenyl] formate?
The canonical SMILES for ethane;[2-methyl-6-(methylamino)-4-nitrophenyl] formate is CC.CNc1cc([N+](=O)[O-])cc(C)c1OC=O.
What is the InChIKey of ethane;[2-methyl-6-(methylamino)-4-nitrophenyl] formate?
The InChIKey is WEFLVVPDUAXEAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O4.C2H6/c1-6-3-7(11(13)14)4-8(10-2)9(6)15-5-12;1-2/h3-5,10H,1-2H3;1-2H3.
What are the key properties of ethane;[2-methyl-6-(methylamino)-4-nitrophenyl] formate?
ethane;[2-methyl-6-(methylamino)-4-nitrophenyl] formate has a molecular weight of 240.26 g/mol, XLogP of 2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[2-methyl-6-(methylamino)-4-nitrophenyl] formate is sourced from PubChem (CID 143884541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).