About (5,6-difluoro-2,3-dihydro-1H-inden-2-yl)methanol
(5,6-difluoro-2,3-dihydro-1H-inden-2-yl)methanol (PubChem CID 23292331) has the molecular formula C10H10F2O
and a molecular weight of 184.19 g/mol. Its IUPAC name is (5,6-difluoro-2,3-dihydro-1H-inden-2-yl)methanol.
Molecular Properties
| Compound Name | (5,6-difluoro-2,3-dihydro-1H-inden-2-yl)methanol |
| PubChem CID | 23292331 |
| Molecular Formula | C10H10F2O |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (5,6-difluoro-2,3-dihydro-1H-inden-2-yl)methanol |
| SMILES | OCC1Cc2cc(F)c(F)cc2C1 |
| InChI | InChI=1S/C10H10F2O/c11-9-3-7-1-6(5-13)2-8(7)4-10(9)12/h3-4,6,13H,1-2,5H2 |
| InChIKey | MYIUBTXFTRVRLQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5,6-difluoro-2,3-dihydro-1H-inden-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,6-difluoro-2,3-dihydro-1H-inden-2-yl)methanol?
The IUPAC name of (5,6-difluoro-2,3-dihydro-1H-inden-2-yl)methanol (CID 23292331) is (5,6-difluoro-2,3-dihydro-1H-inden-2-yl)methanol.
What is the SMILES notation for (5,6-difluoro-2,3-dihydro-1H-inden-2-yl)methanol?
The canonical SMILES for (5,6-difluoro-2,3-dihydro-1H-inden-2-yl)methanol is OCC1Cc2cc(F)c(F)cc2C1.
What is the InChIKey of (5,6-difluoro-2,3-dihydro-1H-inden-2-yl)methanol?
The InChIKey is MYIUBTXFTRVRLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2O/c11-9-3-7-1-6(5-13)2-8(7)4-10(9)12/h3-4,6,13H,1-2,5H2.
What are the key properties of (5,6-difluoro-2,3-dihydro-1H-inden-2-yl)methanol?
(5,6-difluoro-2,3-dihydro-1H-inden-2-yl)methanol has a molecular weight of 184.19 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5,6-difluoro-2,3-dihydro-1H-inden-2-yl)methanol is sourced from PubChem (CID 23292331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).