C15H12BrNO4S — CID 1292550
(1-bromo-3-nitro-5,6,7,8-tetrahydronaphthalen-2-yl) thiophene-2-carboxylate (PubChem CID 1292550) has the molecular formula C15H12BrNO4S and a molecular weight of 382.24 g/mol. Its IUPAC name is (1-bromo-3-nitro-5,6,7,8-tetrahydronaphthalen-2-yl) thiophene-2-carboxylate.
| Compound Name | (1-bromo-3-nitro-5,6,7,8-tetrahydronaphthalen-2-yl) thiophene-2-carboxylate |
|---|---|
| PubChem CID | 1292550 |
| Molecular Formula | C15H12BrNO4S |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | (1-bromo-3-nitro-5,6,7,8-tetrahydronaphthalen-2-yl) thiophene-2-carboxylate |
| SMILES | O=C(Oc1c([N+](=O)[O-])cc2c(c1Br)CCCC2)c1cccs1 |
| InChI | InChI=1S/C15H12BrNO4S/c16-13-10-5-2-1-4-9(10)8-11(17(19)20)14(13)21-15(18)12-6-3-7-22-12/h3,6-8H,1-2,4-5H2 |
| InChIKey | HIYBZRKLHHDEBU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|