About [4-(thiophene-2-carbonyloxy)thieno[2,3-f][1]benzothiol-8-yl] thiophene-2-carboxylate
[4-(thiophene-2-carbonyloxy)thieno[2,3-f][1]benzothiol-8-yl] thiophene-2-carboxylate (PubChem CID 138716201) has the molecular formula C20H10O4S4
and a molecular weight of 442.56 g/mol. Its IUPAC name is [4-(thiophene-2-carbonyloxy)thieno[2,3-f][1]benzothiol-8-yl] thiophene-2-carboxylate.
Molecular Properties
| Compound Name | [4-(thiophene-2-carbonyloxy)thieno[2,3-f][1]benzothiol-8-yl] thiophene-2-carboxylate |
| PubChem CID | 138716201 |
| Molecular Formula | C20H10O4S4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 441.95 |
| IUPAC Name | [4-(thiophene-2-carbonyloxy)thieno[2,3-f][1]benzothiol-8-yl] thiophene-2-carboxylate |
| SMILES | O=C(Oc1c2ccsc2c(OC(=O)c2cccs2)c2ccsc12)c1cccs1 |
| InChI | InChI=1S/C20H10O4S4/c21-19(13-3-1-7-25-13)23-15-11-5-9-28-18(11)16(12-6-10-27-17(12)15)24-20(22)14-4-2-8-26-14/h1-10H |
| InChIKey | GXEKGSYILGGYHB-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(thiophene-2-carbonyloxy)thieno[2,3-f][1]benzothiol-8-yl] thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(thiophene-2-carbonyloxy)thieno[2,3-f][1]benzothiol-8-yl] thiophene-2-carboxylate?
The IUPAC name of [4-(thiophene-2-carbonyloxy)thieno[2,3-f][1]benzothiol-8-yl] thiophene-2-carboxylate (CID 138716201) is [4-(thiophene-2-carbonyloxy)thieno[2,3-f][1]benzothiol-8-yl] thiophene-2-carboxylate.
What is the SMILES notation for [4-(thiophene-2-carbonyloxy)thieno[2,3-f][1]benzothiol-8-yl] thiophene-2-carboxylate?
The canonical SMILES for [4-(thiophene-2-carbonyloxy)thieno[2,3-f][1]benzothiol-8-yl] thiophene-2-carboxylate is O=C(Oc1c2ccsc2c(OC(=O)c2cccs2)c2ccsc12)c1cccs1.
What is the InChIKey of [4-(thiophene-2-carbonyloxy)thieno[2,3-f][1]benzothiol-8-yl] thiophene-2-carboxylate?
The InChIKey is GXEKGSYILGGYHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10O4S4/c21-19(13-3-1-7-25-13)23-15-11-5-9-28-18(11)16(12-6-10-27-17(12)15)24-20(22)14-4-2-8-26-14/h1-10H.
What are the key properties of [4-(thiophene-2-carbonyloxy)thieno[2,3-f][1]benzothiol-8-yl] thiophene-2-carboxylate?
[4-(thiophene-2-carbonyloxy)thieno[2,3-f][1]benzothiol-8-yl] thiophene-2-carboxylate has a molecular weight of 442.56 g/mol, XLogP of 6.68, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(thiophene-2-carbonyloxy)thieno[2,3-f][1]benzothiol-8-yl] thiophene-2-carboxylate is sourced from PubChem (CID 138716201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).