About (2,6-dimethylphenyl) thiophene-2-carboxylate
(2,6-dimethylphenyl) thiophene-2-carboxylate (PubChem CID 23010851) has the molecular formula C13H12O2S
and a molecular weight of 232.30 g/mol. Its IUPAC name is (2,6-dimethylphenyl) thiophene-2-carboxylate.
Molecular Properties
| Compound Name | (2,6-dimethylphenyl) thiophene-2-carboxylate |
| PubChem CID | 23010851 |
| Molecular Formula | C13H12O2S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | (2,6-dimethylphenyl) thiophene-2-carboxylate |
| SMILES | Cc1cccc(C)c1OC(=O)c1cccs1 |
| InChI | InChI=1S/C13H12O2S/c1-9-5-3-6-10(2)12(9)15-13(14)11-7-4-8-16-11/h3-8H,1-2H3 |
| InChIKey | NMUAQGRBFUAANB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dimethylphenyl) thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethylphenyl) thiophene-2-carboxylate?
The IUPAC name of (2,6-dimethylphenyl) thiophene-2-carboxylate (CID 23010851) is (2,6-dimethylphenyl) thiophene-2-carboxylate.
What is the SMILES notation for (2,6-dimethylphenyl) thiophene-2-carboxylate?
The canonical SMILES for (2,6-dimethylphenyl) thiophene-2-carboxylate is Cc1cccc(C)c1OC(=O)c1cccs1.
What is the InChIKey of (2,6-dimethylphenyl) thiophene-2-carboxylate?
The InChIKey is NMUAQGRBFUAANB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O2S/c1-9-5-3-6-10(2)12(9)15-13(14)11-7-4-8-16-11/h3-8H,1-2H3.
What are the key properties of (2,6-dimethylphenyl) thiophene-2-carboxylate?
(2,6-dimethylphenyl) thiophene-2-carboxylate has a molecular weight of 232.30 g/mol, XLogP of 3.58, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethylphenyl) thiophene-2-carboxylate is sourced from PubChem (CID 23010851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).