About hydron;quinolin-8-yl thiophene-2-carboxylate;chloride
hydron;quinolin-8-yl thiophene-2-carboxylate;chloride (PubChem CID 652773) has the molecular formula C14H10ClNO2S
and a molecular weight of 291.76 g/mol. Its IUPAC name is hydron;quinolin-8-yl thiophene-2-carboxylate;chloride.
Molecular Properties
| Compound Name | hydron;quinolin-8-yl thiophene-2-carboxylate;chloride |
| PubChem CID | 652773 |
| Molecular Formula | C14H10ClNO2S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | hydron;quinolin-8-yl thiophene-2-carboxylate;chloride |
| SMILES | O=C(Oc1cccc2cccnc12)c1cccs1.[Cl-].[H+] |
| InChI | InChI=1S/C14H9NO2S.ClH/c16-14(12-7-3-9-18-12)17-11-6-1-4-10-5-2-8-15-13(10)11;/h1-9H;1H |
| InChIKey | LYWBUZFSUSAVGV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze hydron;quinolin-8-yl thiophene-2-carboxylate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;quinolin-8-yl thiophene-2-carboxylate;chloride?
The IUPAC name of hydron;quinolin-8-yl thiophene-2-carboxylate;chloride (CID 652773) is hydron;quinolin-8-yl thiophene-2-carboxylate;chloride.
What is the SMILES notation for hydron;quinolin-8-yl thiophene-2-carboxylate;chloride?
The canonical SMILES for hydron;quinolin-8-yl thiophene-2-carboxylate;chloride is O=C(Oc1cccc2cccnc12)c1cccs1.[Cl-].[H+].
What is the InChIKey of hydron;quinolin-8-yl thiophene-2-carboxylate;chloride?
The InChIKey is LYWBUZFSUSAVGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO2S.ClH/c16-14(12-7-3-9-18-12)17-11-6-1-4-10-5-2-8-15-13(10)11;/h1-9H;1H.
What are the key properties of hydron;quinolin-8-yl thiophene-2-carboxylate;chloride?
hydron;quinolin-8-yl thiophene-2-carboxylate;chloride has a molecular weight of 291.76 g/mol, XLogP of 0.63, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;quinolin-8-yl thiophene-2-carboxylate;chloride is sourced from PubChem (CID 652773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).