C13H11NO4S — CID 8765772
(2,6-dimethylphenyl) 5-nitrothiophene-2-carboxylate (PubChem CID 8765772) has the molecular formula C13H11NO4S and a molecular weight of 277.30 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 5-nitrothiophene-2-carboxylate.
| Compound Name | (2,6-dimethylphenyl) 5-nitrothiophene-2-carboxylate |
|---|---|
| PubChem CID | 8765772 |
| Molecular Formula | C13H11NO4S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | (2,6-dimethylphenyl) 5-nitrothiophene-2-carboxylate |
| SMILES | Cc1cccc(C)c1OC(=O)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C13H11NO4S/c1-8-4-3-5-9(2)12(8)18-13(15)10-6-7-11(19-10)14(16)17/h3-7H,1-2H3 |
| InChIKey | TVPNDXXCNUBLNL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|