C10H4F2N2O4S2 — CID 10615473
2-[(E)-1,2-difluoro-2-(5-nitrothiophen-2-yl)ethenyl]-5-nitrothiophene (PubChem CID 10615473) has the molecular formula C10H4F2N2O4S2 and a molecular weight of 318.28 g/mol. Its IUPAC name is 2-[(E)-1,2-difluoro-2-(5-nitrothiophen-2-yl)ethenyl]-5-nitrothiophene.
| Compound Name | 2-[(E)-1,2-difluoro-2-(5-nitrothiophen-2-yl)ethenyl]-5-nitrothiophene |
|---|---|
| PubChem CID | 10615473 |
| Molecular Formula | C10H4F2N2O4S2 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | 2-[(E)-1,2-difluoro-2-(5-nitrothiophen-2-yl)ethenyl]-5-nitrothiophene |
| SMILES | O=[N+]([O-])c1ccc(/C(F)=C(\F)c2ccc([N+](=O)[O-])s2)s1 |
| InChI | InChI=1S/C10H4F2N2O4S2/c11-9(5-1-3-7(19-5)13(15)16)10(12)6-2-4-8(20-6)14(17)18/h1-4H/b10-9+ |
| InChIKey | YTTJFOXAIGQWCQ-MDZDMXLPSA-N |
| XLogP | 4.39 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|