C11H7NO4S — CID 101042746
1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione (PubChem CID 101042746) has the molecular formula C11H7NO4S and a molecular weight of 249.25 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione.
| Compound Name | 1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 101042746 |
| Molecular Formula | C11H7NO4S |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)C1C=CC=C1)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H7NO4S/c13-10(7-3-1-2-4-7)11(14)8-5-6-9(17-8)12(15)16/h1-7H |
| InChIKey | SWZUIFBJUGSAMN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|