About 1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione
1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione (PubChem CID 101042746) has the molecular formula C11H7NO4S
and a molecular weight of 249.25 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione.
Molecular Properties
| Compound Name | 1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione |
| PubChem CID | 101042746 |
| Molecular Formula | C11H7NO4S |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)C1C=CC=C1)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H7NO4S/c13-10(7-3-1-2-4-7)11(14)8-5-6-9(17-8)12(15)16/h1-7H |
| InChIKey | SWZUIFBJUGSAMN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione?
The IUPAC name of 1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione (CID 101042746) is 1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione.
What is the SMILES notation for 1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione?
The canonical SMILES for 1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione is O=C(C(=O)C1C=CC=C1)c1ccc([N+](=O)[O-])s1.
What is the InChIKey of 1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione?
The InChIKey is SWZUIFBJUGSAMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO4S/c13-10(7-3-1-2-4-7)11(14)8-5-6-9(17-8)12(15)16/h1-7H.
What are the key properties of 1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione?
1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione has a molecular weight of 249.25 g/mol, XLogP of 2.15, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-2,4-dien-1-yl-2-(5-nitrothiophen-2-yl)ethane-1,2-dione is sourced from PubChem (CID 101042746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).