C9H6BrF2NO2 — CID 177310688
4-bromo-5,7-difluoro-6-nitro-2,3-dihydro-1H-indene (PubChem CID 177310688) has the molecular formula C9H6BrF2NO2 and a molecular weight of 278.05 g/mol. Its IUPAC name is 4-bromo-5,7-difluoro-6-nitro-2,3-dihydro-1H-indene.
| Compound Name | 4-bromo-5,7-difluoro-6-nitro-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 177310688 |
| Molecular Formula | C9H6BrF2NO2 |
| Molecular Weight | 278.05 g/mol |
| Exact Mass | 276.95 |
| IUPAC Name | 4-bromo-5,7-difluoro-6-nitro-2,3-dihydro-1H-indene |
| SMILES | O=[N+]([O-])c1c(F)c(Br)c2c(c1F)CCC2 |
| InChI | InChI=1S/C9H6BrF2NO2/c10-6-4-2-1-3-5(4)7(11)9(8(6)12)13(14)15/h1-3H2 |
| InChIKey | HFQRXCQRFMJGEI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.05 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|