C24H22N8O14 — CID 2749372
1,2,3,4,6,7,8,9-octahydropyrido[3,2-g]quinoline;bis(2,4,6-trinitrophenol) (PubChem CID 2749372) has the molecular formula C24H22N8O14 and a molecular weight of 646.48 g/mol. Its IUPAC name is 1,2,3,4,6,7,8,9-octahydropyrido[3,2-g]quinoline;bis(2,4,6-trinitrophenol).
| Compound Name | 1,2,3,4,6,7,8,9-octahydropyrido[3,2-g]quinoline;bis(2,4,6-trinitrophenol) |
|---|---|
| PubChem CID | 2749372 |
| Molecular Formula | C24H22N8O14 |
| Molecular Weight | 646.48 g/mol |
| Exact Mass | 646.13 |
| IUPAC Name | 1,2,3,4,6,7,8,9-octahydropyrido[3,2-g]quinoline;bis(2,4,6-trinitrophenol) |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.c1c2c(cc3c1CCCN3)NCCC2 |
| InChI | InChI=1S/C12H16N2.2C6H3N3O7/c1-3-9-7-10-4-2-6-14-12(10)8-11(9)13-5-1;2*10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h7-8,13-14H,1-6H2;2*1-2,10H |
| InChIKey | USJLWDVLHPECHL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 323.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|