C19H20N4O8 — CID 165360384
10-oxido-1,2,3,4,5,6,7,8-octahydroacridin-10-ium;2,4,6-trinitrophenol (PubChem CID 165360384) has the molecular formula C19H20N4O8 and a molecular weight of 432.39 g/mol. Its IUPAC name is 10-oxido-1,2,3,4,5,6,7,8-octahydroacridin-10-ium;2,4,6-trinitrophenol.
| Compound Name | 10-oxido-1,2,3,4,5,6,7,8-octahydroacridin-10-ium;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 165360384 |
| Molecular Formula | C19H20N4O8 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 10-oxido-1,2,3,4,5,6,7,8-octahydroacridin-10-ium;2,4,6-trinitrophenol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.[O-][n+]1c2c(cc3c1CCCC3)CCCC2 |
| InChI | InChI=1S/C13H17NO.C6H3N3O7/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h9H,1-8H2;1-2,10H |
| InChIKey | AKFNMMIRQNZKLO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 176.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|