C8H9FN2 — CID 82417148
6-fluoro-2,3-dihydro-1H-indol-5-amine (PubChem CID 82417148) has the molecular formula C8H9FN2 and a molecular weight of 152.17 g/mol. Its IUPAC name is 6-fluoro-2,3-dihydro-1H-indol-5-amine.
| Compound Name | 6-fluoro-2,3-dihydro-1H-indol-5-amine |
|---|---|
| PubChem CID | 82417148 |
| Molecular Formula | C8H9FN2 |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 6-fluoro-2,3-dihydro-1H-indol-5-amine |
| SMILES | Nc1cc2c(cc1F)NCC2 |
| InChI | InChI=1S/C8H9FN2/c9-6-4-8-5(1-2-11-8)3-7(6)10/h3-4,11H,1-2,10H2 |
| InChIKey | FPDMYEFUMKNHSX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|