C8H7Br2N — CID 82626452
5,6-dibromo-2,3-dihydro-1H-indole (PubChem CID 82626452) has the molecular formula C8H7Br2N and a molecular weight of 276.96 g/mol. Its IUPAC name is 5,6-dibromo-2,3-dihydro-1H-indole.
| Compound Name | 5,6-dibromo-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 82626452 |
| Molecular Formula | C8H7Br2N |
| Molecular Weight | 276.96 g/mol |
| Exact Mass | 274.89 |
| IUPAC Name | 5,6-dibromo-2,3-dihydro-1H-indole |
| SMILES | Brc1cc2c(cc1Br)NCC2 |
| InChI | InChI=1S/C8H7Br2N/c9-6-3-5-1-2-11-8(5)4-7(6)10/h3-4,11H,1-2H2 |
| InChIKey | BSXROYZIOUZIAZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.96 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |