C9H11BrN2 — CID 82391421
6-bromo-1,2,3,4-tetrahydroquinolin-7-amine (PubChem CID 82391421) has the molecular formula C9H11BrN2 and a molecular weight of 227.10 g/mol. Its IUPAC name is 6-bromo-1,2,3,4-tetrahydroquinolin-7-amine.
| Compound Name | 6-bromo-1,2,3,4-tetrahydroquinolin-7-amine |
|---|---|
| PubChem CID | 82391421 |
| Molecular Formula | C9H11BrN2 |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 6-bromo-1,2,3,4-tetrahydroquinolin-7-amine |
| SMILES | Nc1cc2c(cc1Br)CCCN2 |
| InChI | InChI=1S/C9H11BrN2/c10-7-4-6-2-1-3-12-9(6)5-8(7)11/h4-5,12H,1-3,11H2 |
| InChIKey | OVVRFWAGGIIWPJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|