C12H14N2O — CID 2749367
3,4,6,7,8,9-hexahydro-1H-pyrido[3,2-g]quinolin-2-one (PubChem CID 2749367) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 3,4,6,7,8,9-hexahydro-1H-pyrido[3,2-g]quinolin-2-one.
| Compound Name | 3,4,6,7,8,9-hexahydro-1H-pyrido[3,2-g]quinolin-2-one |
|---|---|
| PubChem CID | 2749367 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3,4,6,7,8,9-hexahydro-1H-pyrido[3,2-g]quinolin-2-one |
| SMILES | O=C1CCc2cc3c(cc2N1)NCCC3 |
| InChI | InChI=1S/C12H14N2O/c15-12-4-3-9-6-8-2-1-5-13-10(8)7-11(9)14-12/h6-7,13H,1-5H2,(H,14,15) |
| InChIKey | UJESBINIPWIYCT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |