C9H9BrN2O — CID 117209588
6-amino-7-bromo-3,4-dihydro-1H-quinolin-2-one (PubChem CID 117209588) has the molecular formula C9H9BrN2O and a molecular weight of 241.09 g/mol. Its IUPAC name is 6-amino-7-bromo-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-amino-7-bromo-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 117209588 |
| Molecular Formula | C9H9BrN2O |
| Molecular Weight | 241.09 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | 6-amino-7-bromo-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Nc1cc2c(cc1Br)NC(=O)CC2 |
| InChI | InChI=1S/C9H9BrN2O/c10-6-4-8-5(3-7(6)11)1-2-9(13)12-8/h3-4H,1-2,11H2,(H,12,13) |
| InChIKey | LMXJFUGCSMBIDE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.09 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|