C10H9BrFNO — CID 139310481
8-bromo-7-fluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 139310481) has the molecular formula C10H9BrFNO and a molecular weight of 258.09 g/mol. Its IUPAC name is 8-bromo-7-fluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 8-bromo-7-fluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 139310481 |
| Molecular Formula | C10H9BrFNO |
| Molecular Weight | 258.09 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 8-bromo-7-fluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1CCCc2cc(F)c(Br)cc2N1 |
| InChI | InChI=1S/C10H9BrFNO/c11-7-5-9-6(4-8(7)12)2-1-3-10(14)13-9/h4-5H,1-3H2,(H,13,14) |
| InChIKey | KYUWRTMJCWUZEF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.09 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |