C10H11NOS — CID 43165333
7-sulfanyl-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 43165333) has the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. Its IUPAC name is 7-sulfanyl-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 7-sulfanyl-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 43165333 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 7-sulfanyl-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1CCCc2cc(S)ccc2N1 |
| InChI | InChI=1S/C10H11NOS/c12-10-3-1-2-7-6-8(13)4-5-9(7)11-10/h4-6,13H,1-3H2,(H,11,12) |
| InChIKey | NARQPFCVRTUSOO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|