C16H15NOS — CID 70557702
bicyclo[3.1.1]hepta-1(6),2,4-triene;6-sulfanyl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 70557702) has the molecular formula C16H15NOS and a molecular weight of 269.37 g/mol. Its IUPAC name is bicyclo[3.1.1]hepta-1(6),2,4-triene;6-sulfanyl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | bicyclo[3.1.1]hepta-1(6),2,4-triene;6-sulfanyl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 70557702 |
| Molecular Formula | C16H15NOS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | bicyclo[3.1.1]hepta-1(6),2,4-triene;6-sulfanyl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(S)ccc2N1.c1cc2cc(c1)C2 |
| InChI | InChI=1S/C9H9NOS.C7H6/c11-9-4-1-6-5-7(12)2-3-8(6)10-9;1-2-6-4-7(3-1)5-6/h2-3,5,12H,1,4H2,(H,10,11);1-4H,5H2 |
| InChIKey | UDJMOQCNKSFSLD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|