C16H11Cl2NO2 — CID 43160665
6-(2,6-dichlorobenzoyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 43160665) has the molecular formula C16H11Cl2NO2 and a molecular weight of 320.18 g/mol. Its IUPAC name is 6-(2,6-dichlorobenzoyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(2,6-dichlorobenzoyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 43160665 |
| Molecular Formula | C16H11Cl2NO2 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 6-(2,6-dichlorobenzoyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(=O)c3c(Cl)cccc3Cl)ccc2N1 |
| InChI | InChI=1S/C16H11Cl2NO2/c17-11-2-1-3-12(18)15(11)16(21)10-4-6-13-9(8-10)5-7-14(20)19-13/h1-4,6,8H,5,7H2,(H,19,20) |
| InChIKey | RGRIACVTAQCZEJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |