C13H16N2O2 — CID 116915356
6-(2-amino-2-methylpropanoyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 116915356) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 6-(2-amino-2-methylpropanoyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(2-amino-2-methylpropanoyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 116915356 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 6-(2-amino-2-methylpropanoyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CC(C)(N)C(=O)c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C13H16N2O2/c1-13(2,14)12(17)9-3-5-10-8(7-9)4-6-11(16)15-10/h3,5,7H,4,6,14H2,1-2H3,(H,15,16) |
| InChIKey | MIMXPHCMBKEEAQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |