C14H12N2O2 — CID 70502328
6-(pyrrole-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 70502328) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 6-(pyrrole-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(pyrrole-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 70502328 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 6-(pyrrole-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(=O)n3cccc3)ccc2N1 |
| InChI | InChI=1S/C14H12N2O2/c17-13-6-4-10-9-11(3-5-12(10)15-13)14(18)16-7-1-2-8-16/h1-3,5,7-9H,4,6H2,(H,15,17) |
| InChIKey | BQQKEUWYRNTXMK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |