C17H21N3O2 — CID 126811624
6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 126811624) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 126811624 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 6-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CN1C[C@@H]2CN(C(=O)c3ccc4c(c3)CCC(=O)N4)C[C@@H]2C1 |
| InChI | InChI=1S/C17H21N3O2/c1-19-7-13-9-20(10-14(13)8-19)17(22)12-2-4-15-11(6-12)3-5-16(21)18-15/h2,4,6,13-14H,3,5,7-10H2,1H3,(H,18,21)/t13-,14+ |
| InChIKey | FNJNMQTYOVGRBU-OKILXGFUSA-N |
| XLogP | 1.20 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |