C15H19N3O2 — CID 95475622
6-(1,4-diazepane-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 95475622) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 6-(1,4-diazepane-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(1,4-diazepane-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 95475622 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 6-(1,4-diazepane-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(=O)N3CCCNCC3)ccc2N1 |
| InChI | InChI=1S/C15H19N3O2/c19-14-5-3-11-10-12(2-4-13(11)17-14)15(20)18-8-1-6-16-7-9-18/h2,4,10,16H,1,3,5-9H2,(H,17,19) |
| InChIKey | DUWNIQRCLAGAHD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |