C15H18N2O3 — CID 103605924
6-(3-hydroxypiperidine-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 103605924) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 6-(3-hydroxypiperidine-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(3-hydroxypiperidine-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 103605924 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 6-(3-hydroxypiperidine-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(=O)N3CCCC(O)C3)ccc2N1 |
| InChI | InChI=1S/C15H18N2O3/c18-12-2-1-7-17(9-12)15(20)11-3-5-13-10(8-11)4-6-14(19)16-13/h3,5,8,12,18H,1-2,4,6-7,9H2,(H,16,19) |
| InChIKey | HPBRDOGMIFBFHL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |