C12H17NO — CID 91147283
ethane;1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 91147283) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is ethane;1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | ethane;1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 91147283 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | ethane;1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | CC.O=C1CCCc2ccccc2N1 |
| InChI | InChI=1S/C10H11NO.C2H6/c12-10-7-3-5-8-4-1-2-6-9(8)11-10;1-2/h1-2,4,6H,3,5,7H2,(H,11,12);1-2H3 |
| InChIKey | KQQLNEHXWCHADA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |