C10H13NO4S — CID 21248382
3,4-dihydro-1H-quinolin-2-one;methanesulfonic acid (PubChem CID 21248382) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is 3,4-dihydro-1H-quinolin-2-one;methanesulfonic acid.
| Compound Name | 3,4-dihydro-1H-quinolin-2-one;methanesulfonic acid |
|---|---|
| PubChem CID | 21248382 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 3,4-dihydro-1H-quinolin-2-one;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.O=C1CCc2ccccc2N1 |
| InChI | InChI=1S/C9H9NO.CH4O3S/c11-9-6-5-7-3-1-2-4-8(7)10-9;1-5(2,3)4/h1-4H,5-6H2,(H,10,11);1H3,(H,2,3,4) |
| InChIKey | KMJQPVHLWQWTDW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|