About 2,3-dihydro-1H-benzo[g]indole;3,4-dihydro-1H-quinolin-2-one
2,3-dihydro-1H-benzo[g]indole;3,4-dihydro-1H-quinolin-2-one (PubChem CID 175227855) has the molecular formula C21H20N2O
and a molecular weight of 316.40 g/mol. Its IUPAC name is 2,3-dihydro-1H-benzo[g]indole;3,4-dihydro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-benzo[g]indole;3,4-dihydro-1H-quinolin-2-one |
| PubChem CID | 175227855 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 2,3-dihydro-1H-benzo[g]indole;3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2ccccc2N1.c1ccc2c3c(ccc2c1)CCN3 |
| InChI | InChI=1S/C12H11N.C9H9NO/c1-2-4-11-9(3-1)5-6-10-7-8-13-12(10)11;11-9-6-5-7-3-1-2-4-8(7)10-9/h1-6,13H,7-8H2;1-4H,5-6H2,(H,10,11) |
| InChIKey | CCDQMGZRXRSTTM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dihydro-1H-benzo[g]indole;3,4-dihydro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-benzo[g]indole;3,4-dihydro-1H-quinolin-2-one?
The IUPAC name of 2,3-dihydro-1H-benzo[g]indole;3,4-dihydro-1H-quinolin-2-one (CID 175227855) is 2,3-dihydro-1H-benzo[g]indole;3,4-dihydro-1H-quinolin-2-one.
What is the SMILES notation for 2,3-dihydro-1H-benzo[g]indole;3,4-dihydro-1H-quinolin-2-one?
The canonical SMILES for 2,3-dihydro-1H-benzo[g]indole;3,4-dihydro-1H-quinolin-2-one is O=C1CCc2ccccc2N1.c1ccc2c3c(ccc2c1)CCN3.
What is the InChIKey of 2,3-dihydro-1H-benzo[g]indole;3,4-dihydro-1H-quinolin-2-one?
The InChIKey is CCDQMGZRXRSTTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.C9H9NO/c1-2-4-11-9(3-1)5-6-10-7-8-13-12(10)11;11-9-6-5-7-3-1-2-4-8(7)10-9/h1-6,13H,7-8H2;1-4H,5-6H2,(H,10,11).
What are the key properties of 2,3-dihydro-1H-benzo[g]indole;3,4-dihydro-1H-quinolin-2-one?
2,3-dihydro-1H-benzo[g]indole;3,4-dihydro-1H-quinolin-2-one has a molecular weight of 316.40 g/mol, XLogP of 4.38, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-benzo[g]indole;3,4-dihydro-1H-quinolin-2-one is sourced from PubChem (CID 175227855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).