C8H11N3O3S — CID 160648154
1,3-dihydroindol-2-one;sulfamide (PubChem CID 160648154) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is 1,3-dihydroindol-2-one;sulfamide.
| Compound Name | 1,3-dihydroindol-2-one;sulfamide |
|---|---|
| PubChem CID | 160648154 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 1,3-dihydroindol-2-one;sulfamide |
| SMILES | NS(N)(=O)=O.O=C1Cc2ccccc2N1 |
| InChI | InChI=1S/C8H7NO.H4N2O2S/c10-8-5-6-3-1-2-4-7(6)9-8;1-5(2,3)4/h1-4H,5H2,(H,9,10);(H4,1,2,3,4) |
| InChIKey | RKBIDWQSZFNUID-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |