C12H13NO6 — CID 66903255
1,3-dihydroindol-2-one;2-hydroxybutanedioic acid (PubChem CID 66903255) has the molecular formula C12H13NO6 and a molecular weight of 267.24 g/mol. Its IUPAC name is 1,3-dihydroindol-2-one;2-hydroxybutanedioic acid.
| Compound Name | 1,3-dihydroindol-2-one;2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 66903255 |
| Molecular Formula | C12H13NO6 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 1,3-dihydroindol-2-one;2-hydroxybutanedioic acid |
| SMILES | O=C(O)CC(O)C(=O)O.O=C1Cc2ccccc2N1 |
| InChI | InChI=1S/C8H7NO.C4H6O5/c10-8-5-6-3-1-2-4-7(6)9-8;5-2(4(8)9)1-3(6)7/h1-4H,5H2,(H,9,10);2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | FFNDYDKHJWJUGB-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |