About 1,3-dihydroindol-2-one;pyrrolo[3,2-b]pyrrole
1,3-dihydroindol-2-one;pyrrolo[3,2-b]pyrrole (PubChem CID 175423185) has the molecular formula C14H11N3O
and a molecular weight of 237.26 g/mol. Its IUPAC name is 1,3-dihydroindol-2-one;pyrrolo[3,2-b]pyrrole.
Molecular Properties
| Compound Name | 1,3-dihydroindol-2-one;pyrrolo[3,2-b]pyrrole |
| PubChem CID | 175423185 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 1,3-dihydroindol-2-one;pyrrolo[3,2-b]pyrrole |
| SMILES | C1=NC2=CC=NC2=C1.O=C1Cc2ccccc2N1 |
| InChI | InChI=1S/C8H7NO.C6H4N2/c10-8-5-6-3-1-2-4-7(6)9-8;1-3-7-6-2-4-8-5(1)6/h1-4H,5H2,(H,9,10);1-4H |
| InChIKey | RJHRMIRVYDLHNI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-dihydroindol-2-one;pyrrolo[3,2-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydroindol-2-one;pyrrolo[3,2-b]pyrrole?
The IUPAC name of 1,3-dihydroindol-2-one;pyrrolo[3,2-b]pyrrole (CID 175423185) is 1,3-dihydroindol-2-one;pyrrolo[3,2-b]pyrrole.
What is the SMILES notation for 1,3-dihydroindol-2-one;pyrrolo[3,2-b]pyrrole?
The canonical SMILES for 1,3-dihydroindol-2-one;pyrrolo[3,2-b]pyrrole is C1=NC2=CC=NC2=C1.O=C1Cc2ccccc2N1.
What is the InChIKey of 1,3-dihydroindol-2-one;pyrrolo[3,2-b]pyrrole?
The InChIKey is RJHRMIRVYDLHNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO.C6H4N2/c10-8-5-6-3-1-2-4-7(6)9-8;1-3-7-6-2-4-8-5(1)6/h1-4H,5H2,(H,9,10);1-4H.
What are the key properties of 1,3-dihydroindol-2-one;pyrrolo[3,2-b]pyrrole?
1,3-dihydroindol-2-one;pyrrolo[3,2-b]pyrrole has a molecular weight of 237.26 g/mol, XLogP of 2.10, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydroindol-2-one;pyrrolo[3,2-b]pyrrole is sourced from PubChem (CID 175423185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).