C14H11NOS — CID 21481215
6-phenylsulfanyl-1,3-dihydroindol-2-one (PubChem CID 21481215) has the molecular formula C14H11NOS and a molecular weight of 241.32 g/mol. Its IUPAC name is 6-phenylsulfanyl-1,3-dihydroindol-2-one.
| Compound Name | 6-phenylsulfanyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 21481215 |
| Molecular Formula | C14H11NOS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 6-phenylsulfanyl-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2ccc(Sc3ccccc3)cc2N1 |
| InChI | InChI=1S/C14H11NOS/c16-14-8-10-6-7-12(9-13(10)15-14)17-11-4-2-1-3-5-11/h1-7,9H,8H2,(H,15,16) |
| InChIKey | NBYQSHSIUKACAQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |