C28H22N2O5S2 — CID 159958365
2-(2-nitro-5-phenylsulfanylphenyl)acetic acid;5-phenylsulfanyl-1,3-dihydroindol-2-one (PubChem CID 159958365) has the molecular formula C28H22N2O5S2 and a molecular weight of 530.63 g/mol. Its IUPAC name is 2-(2-nitro-5-phenylsulfanylphenyl)acetic acid;5-phenylsulfanyl-1,3-dihydroindol-2-one.
| Compound Name | 2-(2-nitro-5-phenylsulfanylphenyl)acetic acid;5-phenylsulfanyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 159958365 |
| Molecular Formula | C28H22N2O5S2 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | 2-(2-nitro-5-phenylsulfanylphenyl)acetic acid;5-phenylsulfanyl-1,3-dihydroindol-2-one |
| SMILES | O=C(O)Cc1cc(Sc2ccccc2)ccc1[N+](=O)[O-].O=C1Cc2cc(Sc3ccccc3)ccc2N1 |
| InChI | InChI=1S/C14H11NO4S.C14H11NOS/c16-14(17)9-10-8-12(6-7-13(10)15(18)19)20-11-4-2-1-3-5-11;16-14-9-10-8-12(6-7-13(10)15-14)17-11-4-2-1-3-5-11/h1-8H,9H2,(H,16,17);1-8H,9H2,(H,15,16) |
| InChIKey | OCZSHGRQGKCTGX-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|