C13H10N2OS — CID 18973044
5-phenylsulfanyl-1,3-dihydropyrrolo[2,3-c]pyridin-2-one (PubChem CID 18973044) has the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. Its IUPAC name is 5-phenylsulfanyl-1,3-dihydropyrrolo[2,3-c]pyridin-2-one.
| Compound Name | 5-phenylsulfanyl-1,3-dihydropyrrolo[2,3-c]pyridin-2-one |
|---|---|
| PubChem CID | 18973044 |
| Molecular Formula | C13H10N2OS |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 5-phenylsulfanyl-1,3-dihydropyrrolo[2,3-c]pyridin-2-one |
| SMILES | O=C1Cc2cc(Sc3ccccc3)ncc2N1 |
| InChI | InChI=1S/C13H10N2OS/c16-12-6-9-7-13(14-8-11(9)15-12)17-10-4-2-1-3-5-10/h1-5,7-8H,6H2,(H,15,16) |
| InChIKey | WSUHHRSHYJKICM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |