C9H10N2O — CID 130380646
5-ethyl-1,3-dihydropyrrolo[2,3-c]pyridin-2-one (PubChem CID 130380646) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 5-ethyl-1,3-dihydropyrrolo[2,3-c]pyridin-2-one.
| Compound Name | 5-ethyl-1,3-dihydropyrrolo[2,3-c]pyridin-2-one |
|---|---|
| PubChem CID | 130380646 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 5-ethyl-1,3-dihydropyrrolo[2,3-c]pyridin-2-one |
| SMILES | CCc1cc2c(cn1)NC(=O)C2 |
| InChI | InChI=1S/C9H10N2O/c1-2-7-3-6-4-9(12)11-8(6)5-10-7/h3,5H,2,4H2,1H3,(H,11,12) |
| InChIKey | OQWYESVVXTZAJU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |