C7H5FN2O — CID 137347254
5-fluoro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one (PubChem CID 137347254) has the molecular formula C7H5FN2O and a molecular weight of 152.13 g/mol. Its IUPAC name is 5-fluoro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one.
| Compound Name | 5-fluoro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one |
|---|---|
| PubChem CID | 137347254 |
| Molecular Formula | C7H5FN2O |
| Molecular Weight | 152.13 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 5-fluoro-1,3-dihydropyrrolo[2,3-c]pyridin-2-one |
| SMILES | O=C1Cc2cc(F)ncc2N1 |
| InChI | InChI=1S/C7H5FN2O/c8-6-1-4-2-7(11)10-5(4)3-9-6/h1,3H,2H2,(H,10,11) |
| InChIKey | HIVGLTBVQGFICA-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.13 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|