C13H10N2O4 — CID 82483292
2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid (PubChem CID 82483292) has the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. Its IUPAC name is 2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid.
| Compound Name | 2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 82483292 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1cc(-c2ccc3c(c2)CC(=O)N3)on1 |
| InChI | InChI=1S/C13H10N2O4/c16-12-4-8-3-7(1-2-10(8)14-12)11-5-9(15-19-11)6-13(17)18/h1-3,5H,4,6H2,(H,14,16)(H,17,18) |
| InChIKey | MKMYRKUCFNPUOO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |