2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid

C13H10N2O4 — CID 82483292

IUPAC2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid
SMILESO=C(O)Cc1cc(-c2ccc3c(c2)CC(=O)N3)on1
InChIInChI=1S/C13H10N2O4/c16-12-4-8-3-7(1-2-10(8)14-12)11-5-9(15-19-11)6-13(17)18/h1-3,5H,4,6H2,(H,14,16)(H,17,18)
InChIKeyMKMYRKUCFNPUOO-UHFFFAOYSA-N
MW258.23 g/mol
LogP1.46
Rot. Bonds3

About 2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid

2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid (PubChem CID 82483292) has the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. Its IUPAC name is 2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid.

Molecular Properties

Compound Name2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid
PubChem CID82483292
Molecular FormulaC13H10N2O4
Molecular Weight258.23 g/mol
Exact Mass258.06
IUPAC Name2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid
SMILESO=C(O)Cc1cc(-c2ccc3c(c2)CC(=O)N3)on1
InChIInChI=1S/C13H10N2O4/c16-12-4-8-3-7(1-2-10(8)14-12)11-5-9(15-19-11)6-13(17)18/h1-3,5H,4,6H2,(H,14,16)(H,17,18)
InChIKeyMKMYRKUCFNPUOO-UHFFFAOYSA-N
XLogP1.46
TPSA92.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.23
LogP ≤ 51.46
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid?
The IUPAC name of 2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid (CID 82483292) is 2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid.
What is the SMILES notation for 2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid?
The canonical SMILES for 2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid is O=C(O)Cc1cc(-c2ccc3c(c2)CC(=O)N3)on1.
What is the InChIKey of 2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid?
The InChIKey is MKMYRKUCFNPUOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O4/c16-12-4-8-3-7(1-2-10(8)14-12)11-5-9(15-19-11)6-13(17)18/h1-3,5H,4,6H2,(H,14,16)(H,17,18).
What are the key properties of 2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid?
2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid has a molecular weight of 258.23 g/mol, XLogP of 1.46, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2-oxo-1,3-dihydroindol-5-yl)-1,2-oxazol-3-yl]acetic acid is sourced from PubChem (CID 82483292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).