C13H11N3O3 — CID 82299815
2-[4-(2-oxo-1,3-dihydroindol-5-yl)imidazol-1-yl]acetic acid (PubChem CID 82299815) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-[4-(2-oxo-1,3-dihydroindol-5-yl)imidazol-1-yl]acetic acid.
| Compound Name | 2-[4-(2-oxo-1,3-dihydroindol-5-yl)imidazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 82299815 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-[4-(2-oxo-1,3-dihydroindol-5-yl)imidazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cnc(-c2ccc3c(c2)CC(=O)N3)c1 |
| InChI | InChI=1S/C13H11N3O3/c17-12-4-9-3-8(1-2-10(9)15-12)11-5-16(7-14-11)6-13(18)19/h1-3,5,7H,4,6H2,(H,15,17)(H,18,19) |
| InChIKey | SOARJOYFHNLJPZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |